C27H32ClN3O3 — CID 42843741
4-chloro-N-(3-methoxypropyl)-N-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide (PubChem CID 42843741) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is 4-chloro-N-(3-methoxypropyl)-N-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-(3-methoxypropyl)-N-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42843741 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 4-chloro-N-(3-methoxypropyl)-N-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide |
| SMILES | COCCCN(Cc1c(-c2ccccc2)noc1N1CCCCC1C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H32ClN3O3/c1-20-9-6-7-17-31(20)27-24(25(29-34-27)21-10-4-3-5-11-21)19-30(16-8-18-33-2)26(32)22-12-14-23(28)15-13-22/h3-5,10-15,20H,6-9,16-19H2,1-2H3 |
| InChIKey | JNDHRNZGRCQJAS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|