C24H33N3O4 — CID 46015022
N-(3-methoxypropyl)-N-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]cyclopentanecarboxamide (PubChem CID 46015022) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]cyclopentanecarboxamide.
| Compound Name | N-(3-methoxypropyl)-N-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 46015022 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-(3-methoxypropyl)-N-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]cyclopentanecarboxamide |
| SMILES | COCCCN(Cc1c(-c2ccccc2)noc1N1CCOCC1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C24H33N3O4/c1-29-15-7-12-27(23(28)20-10-5-6-11-20)18-21-22(19-8-3-2-4-9-19)25-31-24(21)26-13-16-30-17-14-26/h2-4,8-9,20H,5-7,10-18H2,1H3 |
| InChIKey | XRQBUVPAWXKJJX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|