C26H30FN3O3 — CID 42843727
2-fluoro-N-(3-methoxypropyl)-N-[(3-phenyl-5-piperidin-1-yl-1,2-oxazol-4-yl)methyl]benzamide (PubChem CID 42843727) has the molecular formula C26H30FN3O3 and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-fluoro-N-(3-methoxypropyl)-N-[(3-phenyl-5-piperidin-1-yl-1,2-oxazol-4-yl)methyl]benzamide.
| Compound Name | 2-fluoro-N-(3-methoxypropyl)-N-[(3-phenyl-5-piperidin-1-yl-1,2-oxazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 42843727 |
| Molecular Formula | C26H30FN3O3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-fluoro-N-(3-methoxypropyl)-N-[(3-phenyl-5-piperidin-1-yl-1,2-oxazol-4-yl)methyl]benzamide |
| SMILES | COCCCN(Cc1c(-c2ccccc2)noc1N1CCCCC1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C26H30FN3O3/c1-32-18-10-17-30(25(31)21-13-6-7-14-23(21)27)19-22-24(20-11-4-2-5-12-20)28-33-26(22)29-15-8-3-9-16-29/h2,4-7,11-14H,3,8-10,15-19H2,1H3 |
| InChIKey | MDRMNBIVVXCVEH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|