C19H30N2O3 — CID 24715644
1-(furan-2-ylmethoxy)-3-[3-methylbutyl-[(1-methylpyrrol-2-yl)methyl]amino]propan-2-ol (PubChem CID 24715644) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethoxy)-3-[3-methylbutyl-[(1-methylpyrrol-2-yl)methyl]amino]propan-2-ol.
| Compound Name | 1-(furan-2-ylmethoxy)-3-[3-methylbutyl-[(1-methylpyrrol-2-yl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 24715644 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-(furan-2-ylmethoxy)-3-[3-methylbutyl-[(1-methylpyrrol-2-yl)methyl]amino]propan-2-ol |
| SMILES | CC(C)CCN(Cc1cccn1C)CC(O)COCc1ccco1 |
| InChI | InChI=1S/C19H30N2O3/c1-16(2)8-10-21(12-17-6-4-9-20(17)3)13-18(22)14-23-15-19-7-5-11-24-19/h4-7,9,11,16,18,22H,8,10,12-15H2,1-3H3 |
| InChIKey | RYMVGIVETUHTJE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |