C24H31FN2O4 — CID 7296193
(2S)-1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 7296193) has the molecular formula C24H31FN2O4 and a molecular weight of 430.52 g/mol. Its IUPAC name is (2S)-1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | (2S)-1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 7296193 |
| Molecular Formula | C24H31FN2O4 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (2S)-1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | COCCCN(Cc1cccn1Cc1ccccc1F)C[C@H](O)COCc1ccco1 |
| InChI | InChI=1S/C24H31FN2O4/c1-29-13-6-11-26(17-22(28)18-30-19-23-9-5-14-31-23)16-21-8-4-12-27(21)15-20-7-2-3-10-24(20)25/h2-5,7-10,12,14,22,28H,6,11,13,15-19H2,1H3/t22-/m0/s1 |
| InChIKey | BKNIIOPNMNWCIN-QFIPXVFZSA-N |
| XLogP | 3.68 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|