C24H22ClN5O2S — CID 24720213
4-(7-chloro-2-thiophen-2-ylquinazolin-4-yl)-N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 24720213) has the molecular formula C24H22ClN5O2S and a molecular weight of 479.99 g/mol. Its IUPAC name is 4-(7-chloro-2-thiophen-2-ylquinazolin-4-yl)-N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(7-chloro-2-thiophen-2-ylquinazolin-4-yl)-N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 24720213 |
| Molecular Formula | C24H22ClN5O2S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 4-(7-chloro-2-thiophen-2-ylquinazolin-4-yl)-N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3nc(-c4cccs4)nc4cc(Cl)ccc34)CC2)cc1 |
| InChI | InChI=1S/C24H22ClN5O2S/c1-32-18-7-5-17(6-8-18)26-24(31)30-12-10-29(11-13-30)23-19-9-4-16(25)15-20(19)27-22(28-23)21-3-2-14-33-21/h2-9,14-15H,10-13H2,1H3,(H,26,31) |
| InChIKey | HRAKDDLMNFKBNM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |