C21H18Cl2N4O — CID 24720499
N-[3-tert-butyl-1-(2,5-dichlorophenyl)pyrazol-5-yl]-3-cyanobenzamide (PubChem CID 24720499) has the molecular formula C21H18Cl2N4O and a molecular weight of 413.31 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(2,5-dichlorophenyl)pyrazol-5-yl]-3-cyanobenzamide.
| Compound Name | N-[3-tert-butyl-1-(2,5-dichlorophenyl)pyrazol-5-yl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 24720499 |
| Molecular Formula | C21H18Cl2N4O |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[3-tert-butyl-1-(2,5-dichlorophenyl)pyrazol-5-yl]-3-cyanobenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2cccc(C#N)c2)n(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C21H18Cl2N4O/c1-21(2,3)18-11-19(25-20(28)14-6-4-5-13(9-14)12-24)27(26-18)17-10-15(22)7-8-16(17)23/h4-11H,1-3H3,(H,25,28) |
| InChIKey | SDLYXXGCOAGAJM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |