C27H33N3O3 — CID 24732926
1-[4-[4-[6-(dimethylamino)-3-pyridinyl]phenoxy]piperidin-1-yl]-3-phenoxypropan-2-ol (PubChem CID 24732926) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-[4-[4-[6-(dimethylamino)-3-pyridinyl]phenoxy]piperidin-1-yl]-3-phenoxypropan-2-ol.
| Compound Name | 1-[4-[4-[6-(dimethylamino)-3-pyridinyl]phenoxy]piperidin-1-yl]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 24732926 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-[4-[4-[6-(dimethylamino)-3-pyridinyl]phenoxy]piperidin-1-yl]-3-phenoxypropan-2-ol |
| SMILES | CN(C)c1ccc(-c2ccc(OC3CCN(CC(O)COc4ccccc4)CC3)cc2)cn1 |
| InChI | InChI=1S/C27H33N3O3/c1-29(2)27-13-10-22(18-28-27)21-8-11-25(12-9-21)33-26-14-16-30(17-15-26)19-23(31)20-32-24-6-4-3-5-7-24/h3-13,18,23,26,31H,14-17,19-20H2,1-2H3 |
| InChIKey | CLJCAUXFDNINKC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |