C23H24F2N4O — CID 24733892
N-(2,4-difluorophenyl)-4-(3-quinolin-3-ylpropyl)piperazine-1-carboxamide (PubChem CID 24733892) has the molecular formula C23H24F2N4O and a molecular weight of 410.47 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(3-quinolin-3-ylpropyl)piperazine-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(3-quinolin-3-ylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 24733892 |
| Molecular Formula | C23H24F2N4O |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(3-quinolin-3-ylpropyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CCN(CCCc2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H24F2N4O/c24-19-7-8-22(20(25)15-19)27-23(30)29-12-10-28(11-13-29)9-3-4-17-14-18-5-1-2-6-21(18)26-16-17/h1-2,5-8,14-16H,3-4,9-13H2,(H,27,30) |
| InChIKey | OGTGDNCSSUPALJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |