C25H25Cl2FN2O — CID 24738252
N-[(4-tert-butylphenyl)methyl]-N-[2-(3,4-dichlorophenyl)ethyl]-2-fluoropyridine-3-carboxamide (PubChem CID 24738252) has the molecular formula C25H25Cl2FN2O and a molecular weight of 459.39 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-[2-(3,4-dichlorophenyl)ethyl]-2-fluoropyridine-3-carboxamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-[2-(3,4-dichlorophenyl)ethyl]-2-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 24738252 |
| Molecular Formula | C25H25Cl2FN2O |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-[2-(3,4-dichlorophenyl)ethyl]-2-fluoropyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(CN(CCc2ccc(Cl)c(Cl)c2)C(=O)c2cccnc2F)cc1 |
| InChI | InChI=1S/C25H25Cl2FN2O/c1-25(2,3)19-9-6-18(7-10-19)16-30(24(31)20-5-4-13-29-23(20)28)14-12-17-8-11-21(26)22(27)15-17/h4-11,13,15H,12,14,16H2,1-3H3 |
| InChIKey | WBCROFBFAPKMMK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|