C25H19Cl3F7N3O — CID 87542554
5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-2-(methylamino)pyridine-3-carboxamide (PubChem CID 87542554) has the molecular formula C25H19Cl3F7N3O and a molecular weight of 616.79 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87542554 |
| Molecular Formula | C25H19Cl3F7N3O |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncc(Cl)cc1C(=O)N(CCc1ccc(Cl)c(Cl)c1)Cc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H19Cl3F7N3O/c1-36-21-18(11-17(26)12-37-21)22(39)38(9-8-14-4-7-19(27)20(28)10-14)13-15-2-5-16(6-3-15)23(29,24(30,31)32)25(33,34)35/h2-7,10-12H,8-9,13H2,1H3,(H,36,37) |
| InChIKey | IDZZLCQXOVAYPW-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |