C26H24ClF5N2O — CID 87542288
5-chloro-2-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]benzamide (PubChem CID 87542288) has the molecular formula C26H24ClF5N2O and a molecular weight of 510.93 g/mol. Its IUPAC name is 5-chloro-2-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]benzamide.
| Compound Name | 5-chloro-2-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 87542288 |
| Molecular Formula | C26H24ClF5N2O |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 5-chloro-2-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]benzamide |
| SMILES | CNc1ccc(Cl)cc1C(=O)N(CCc1ccc(C)cc1)Cc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H24ClF5N2O/c1-17-3-5-18(6-4-17)13-14-34(24(35)22-15-21(27)11-12-23(22)33-2)16-19-7-9-20(10-8-19)25(28,29)26(30,31)32/h3-12,15,33H,13-14,16H2,1-2H3 |
| InChIKey | DJZDRFXIXOOIAY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|