C25H23ClF5N3O — CID 91453050
6-chloro-3-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]pyridine-2-carboxamide (PubChem CID 91453050) has the molecular formula C25H23ClF5N3O and a molecular weight of 511.92 g/mol. Its IUPAC name is 6-chloro-3-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91453050 |
| Molecular Formula | C25H23ClF5N3O |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 6-chloro-3-(methylamino)-N-[2-(4-methylphenyl)ethyl]-N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]pyridine-2-carboxamide |
| SMILES | CNc1ccc(Cl)nc1C(=O)N(CCc1ccc(C)cc1)Cc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23ClF5N3O/c1-16-3-5-17(6-4-16)13-14-34(23(35)22-20(32-2)11-12-21(26)33-22)15-18-7-9-19(10-8-18)24(27,28)25(29,30)31/h3-12,32H,13-15H2,1-2H3 |
| InChIKey | QEKYLHHOQPIPEF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|