C25H20Cl2F7N3O — CID 87542625
2-chloro-N-[2-(4-chlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-5-(methylamino)pyridine-4-carboxamide (PubChem CID 87542625) has the molecular formula C25H20Cl2F7N3O and a molecular weight of 582.35 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-chlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-5-(methylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(4-chlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-5-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87542625 |
| Molecular Formula | C25H20Cl2F7N3O |
| Molecular Weight | 582.35 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | 2-chloro-N-[2-(4-chlorophenyl)ethyl]-N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-5-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cnc(Cl)cc1C(=O)N(CCc1ccc(Cl)cc1)Cc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20Cl2F7N3O/c1-35-20-13-36-21(27)12-19(20)22(38)37(11-10-15-4-8-18(26)9-5-15)14-16-2-6-17(7-3-16)23(28,24(29,30)31)25(32,33)34/h2-9,12-13,35H,10-11,14H2,1H3 |
| InChIKey | UTYYBWOUOBIWSF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.35 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|