C25H20Cl2F3N3O2 — CID 87542775
5-chloro-N-[2-(4-chlorophenyl)ethyl]-2-(cyanomethylamino)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 87542775) has the molecular formula C25H20Cl2F3N3O2 and a molecular weight of 522.35 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-chlorophenyl)ethyl]-2-(cyanomethylamino)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 5-chloro-N-[2-(4-chlorophenyl)ethyl]-2-(cyanomethylamino)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 87542775 |
| Molecular Formula | C25H20Cl2F3N3O2 |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 5-chloro-N-[2-(4-chlorophenyl)ethyl]-2-(cyanomethylamino)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | N#CCNc1ccc(Cl)cc1C(=O)N(CCc1ccc(Cl)cc1)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20Cl2F3N3O2/c26-19-5-1-17(2-6-19)11-14-33(16-18-3-8-21(9-4-18)35-25(28,29)30)24(34)22-15-20(27)7-10-23(22)32-13-12-31/h1-10,15,32H,11,13-14,16H2 |
| InChIKey | WNBYXDOQYKCZRK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|