C28H24Cl2F3N3O2 — CID 87543735
2,3-dichloro-6-(cyanomethylamino)-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide (PubChem CID 87543735) has the molecular formula C28H24Cl2F3N3O2 and a molecular weight of 562.42 g/mol. Its IUPAC name is 2,3-dichloro-6-(cyanomethylamino)-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide.
| Compound Name | 2,3-dichloro-6-(cyanomethylamino)-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 87543735 |
| Molecular Formula | C28H24Cl2F3N3O2 |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 2,3-dichloro-6-(cyanomethylamino)-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
| SMILES | N#CCNc1ccc(Cl)c(Cl)c1C(=O)N(CCc1cccc(OC(F)(F)F)c1)Cc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C28H24Cl2F3N3O2/c29-23-10-11-24(35-14-13-34)25(26(23)30)27(37)36(17-19-4-6-20(7-5-19)21-8-9-21)15-12-18-2-1-3-22(16-18)38-28(31,32)33/h1-7,10-11,16,21,35H,8-9,12,14-15,17H2 |
| InChIKey | XMVJUNZIJGWJHB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|