C26H20ClF6N3O2 — CID 87542931
5-chloro-2-[cyano(methyl)amino]-N-[[4-(trifluoromethoxy)phenyl]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 87542931) has the molecular formula C26H20ClF6N3O2 and a molecular weight of 555.91 g/mol. Its IUPAC name is 5-chloro-2-[cyano(methyl)amino]-N-[[4-(trifluoromethoxy)phenyl]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 5-chloro-2-[cyano(methyl)amino]-N-[[4-(trifluoromethoxy)phenyl]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 87542931 |
| Molecular Formula | C26H20ClF6N3O2 |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 5-chloro-2-[cyano(methyl)amino]-N-[[4-(trifluoromethoxy)phenyl]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | CN(C#N)c1ccc(Cl)cc1C(=O)N(CCc1cccc(C(F)(F)F)c1)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H20ClF6N3O2/c1-35(16-34)23-10-7-20(27)14-22(23)24(37)36(12-11-17-3-2-4-19(13-17)25(28,29)30)15-18-5-8-21(9-6-18)38-26(31,32)33/h2-10,13-14H,11-12,15H2,1H3 |
| InChIKey | HBIJURXZYRQDSZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|