C17H17ClF3N — CID 13478469
N-[(4-chlorophenyl)methyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 13478469) has the molecular formula C17H17ClF3N and a molecular weight of 327.78 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 13478469 |
| Molecular Formula | C17H17ClF3N |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CN(CCc1cccc(C(F)(F)F)c1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClF3N/c1-22(12-14-5-7-16(18)8-6-14)10-9-13-3-2-4-15(11-13)17(19,20)21/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | FPIUDJHYAGOTHZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |