C27H27BrClF3N2O — CID 68699008
2-amino-5-bromo-N-[(4-tert-butylphenyl)methyl]-3-chloro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 68699008) has the molecular formula C27H27BrClF3N2O and a molecular weight of 567.88 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[(4-tert-butylphenyl)methyl]-3-chloro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2-amino-5-bromo-N-[(4-tert-butylphenyl)methyl]-3-chloro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 68699008 |
| Molecular Formula | C27H27BrClF3N2O |
| Molecular Weight | 567.88 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | 2-amino-5-bromo-N-[(4-tert-butylphenyl)methyl]-3-chloro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(CN(CCc2cccc(C(F)(F)F)c2)C(=O)c2cc(Br)cc(Cl)c2N)cc1 |
| InChI | InChI=1S/C27H27BrClF3N2O/c1-26(2,3)19-9-7-18(8-10-19)16-34(25(35)22-14-21(28)15-23(29)24(22)33)12-11-17-5-4-6-20(13-17)27(30,31)32/h4-10,13-15H,11-12,16,33H2,1-3H3 |
| InChIKey | CPXVNWAPFWBYCI-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.88 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|