C28H25ClF3N3O2 — CID 174558755
2-chloro-6-[cyano(methyl)amino]-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide (PubChem CID 174558755) has the molecular formula C28H25ClF3N3O2 and a molecular weight of 527.97 g/mol. Its IUPAC name is 2-chloro-6-[cyano(methyl)amino]-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide.
| Compound Name | 2-chloro-6-[cyano(methyl)amino]-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 174558755 |
| Molecular Formula | C28H25ClF3N3O2 |
| Molecular Weight | 527.97 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-chloro-6-[cyano(methyl)amino]-N-[(4-cyclopropylphenyl)methyl]-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
| SMILES | CN(C#N)c1cccc(Cl)c1C(=O)N(CCc1cccc(OC(F)(F)F)c1)Cc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C28H25ClF3N3O2/c1-34(18-33)25-7-3-6-24(29)26(25)27(36)35(17-20-8-10-21(11-9-20)22-12-13-22)15-14-19-4-2-5-23(16-19)37-28(30,31)32/h2-11,16,22H,12-15,17H2,1H3 |
| InChIKey | YXEGHKRPHTXYAR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.97 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|