C24H29BrN2O — CID 24739386
3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidine-1-carbaldehyde (PubChem CID 24739386) has the molecular formula C24H29BrN2O and a molecular weight of 441.41 g/mol. Its IUPAC name is 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidine-1-carbaldehyde.
| Compound Name | 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 24739386 |
| Molecular Formula | C24H29BrN2O |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidine-1-carbaldehyde |
| SMILES | O=CN1CCCC(c2ccccc2)(C2CCN(Cc3ccc(Br)cc3)CC2)C1 |
| InChI | InChI=1S/C24H29BrN2O/c25-23-9-7-20(8-10-23)17-26-15-11-22(12-16-26)24(21-5-2-1-3-6-21)13-4-14-27(18-24)19-28/h1-3,5-10,19,22H,4,11-18H2 |
| InChIKey | ZCILIXHTWZDACI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|