C25H31BrN2O — CID 24739387
1-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]ethanone (PubChem CID 24739387) has the molecular formula C25H31BrN2O and a molecular weight of 455.44 g/mol. Its IUPAC name is 1-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]ethanone.
| Compound Name | 1-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 24739387 |
| Molecular Formula | C25H31BrN2O |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(c2ccccc2)(C2CCN(Cc3ccc(Br)cc3)CC2)C1 |
| InChI | InChI=1S/C25H31BrN2O/c1-20(29)28-15-5-14-25(19-28,22-6-3-2-4-7-22)23-12-16-27(17-13-23)18-21-8-10-24(26)11-9-21/h2-4,6-11,23H,5,12-19H2,1H3 |
| InChIKey | ZZNJOZRGMRQBSR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |