C25H29BrN2O2S — CID 44580878
3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(methylsulfanylmethyl)-3-phenylpiperidine-2,6-dione (PubChem CID 44580878) has the molecular formula C25H29BrN2O2S and a molecular weight of 501.49 g/mol. Its IUPAC name is 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(methylsulfanylmethyl)-3-phenylpiperidine-2,6-dione.
| Compound Name | 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(methylsulfanylmethyl)-3-phenylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 44580878 |
| Molecular Formula | C25H29BrN2O2S |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(methylsulfanylmethyl)-3-phenylpiperidine-2,6-dione |
| SMILES | CSCN1C(=O)CCC(c2ccccc2)(C2CCN(Cc3ccc(Br)cc3)CC2)C1=O |
| InChI | InChI=1S/C25H29BrN2O2S/c1-31-18-28-23(29)11-14-25(24(28)30,20-5-3-2-4-6-20)21-12-15-27(16-13-21)17-19-7-9-22(26)10-8-19/h2-10,21H,11-18H2,1H3 |
| InChIKey | CZSCZZVPYIQJLF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|