C24H18N4O3S2 — CID 2474153
2-[[5-(benzenesulfonyl)-2-phenyl-1H-imidazol-4-yl]sulfanyl]-N-(3-cyanophenyl)acetamide (PubChem CID 2474153) has the molecular formula C24H18N4O3S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is 2-[[5-(benzenesulfonyl)-2-phenyl-1H-imidazol-4-yl]sulfanyl]-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-[[5-(benzenesulfonyl)-2-phenyl-1H-imidazol-4-yl]sulfanyl]-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 2474153 |
| Molecular Formula | C24H18N4O3S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 2-[[5-(benzenesulfonyl)-2-phenyl-1H-imidazol-4-yl]sulfanyl]-N-(3-cyanophenyl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)CSc2nc(-c3ccccc3)[nH]c2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H18N4O3S2/c25-15-17-8-7-11-19(14-17)26-21(29)16-32-23-24(33(30,31)20-12-5-2-6-13-20)28-22(27-23)18-9-3-1-4-10-18/h1-14H,16H2,(H,26,29)(H,27,28) |
| InChIKey | XGPBYHIQLAYPIW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |