C38H34Br2N2 — CID 24743185
3-phenyl-1-[5-[3-[5-(3-phenylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium dibromide (PubChem CID 24743185) has the molecular formula C38H34Br2N2 and a molecular weight of 678.51 g/mol. Its IUPAC name is 3-phenyl-1-[5-[3-[5-(3-phenylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium dibromide.
| Compound Name | 3-phenyl-1-[5-[3-[5-(3-phenylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 24743185 |
| Molecular Formula | C38H34Br2N2 |
| Molecular Weight | 678.51 g/mol |
| Exact Mass | 676.11 |
| IUPAC Name | 3-phenyl-1-[5-[3-[5-(3-phenylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium dibromide |
| SMILES | C(#Cc1cccc(C#CCCC[n+]2cccc(-c3ccccc3)c2)c1)CCC[n+]1cccc(-c2ccccc2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C38H34N2.2BrH/c1-7-20-35(21-8-1)37-24-14-28-39(31-37)26-11-3-5-16-33-18-13-19-34(30-33)17-6-4-12-27-40-29-15-25-38(32-40)36-22-9-2-10-23-36;;/h1-2,7-10,13-15,18-25,28-32H,3-4,11-12,26-27H2;2*1H/q+2;;/p-2 |
| InChIKey | QUMGOBZWXZRZIC-UHFFFAOYSA-L |
| XLogP | 1.27 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|