C20H21FN2O — CID 24743996
5-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-1H-imidazole (PubChem CID 24743996) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 5-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-1H-imidazole.
| Compound Name | 5-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-1H-imidazole |
|---|---|
| PubChem CID | 24743996 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-1H-imidazole |
| SMILES | Fc1ccc(C(OCCCCc2cnc[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21FN2O/c21-18-11-9-17(10-12-18)20(16-6-2-1-3-7-16)24-13-5-4-8-19-14-22-15-23-19/h1-3,6-7,9-12,14-15,20H,4-5,8,13H2,(H,22,23) |
| InChIKey | LUTDIWSOMRHKGZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|