C19H19FN2O — CID 24743997
5-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]-1H-imidazole (PubChem CID 24743997) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 5-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]-1H-imidazole.
| Compound Name | 5-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]-1H-imidazole |
|---|---|
| PubChem CID | 24743997 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]-1H-imidazole |
| SMILES | Fc1ccc(C(OCCCc2cnc[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19FN2O/c20-17-10-8-16(9-11-17)19(15-5-2-1-3-6-15)23-12-4-7-18-13-21-14-22-18/h1-3,5-6,8-11,13-14,19H,4,7,12H2,(H,21,22) |
| InChIKey | BZBKNNRZKSWDNH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|