C12H14O4 — CID 24745561
1-ethynyl-2,3-bis(methoxymethoxy)benzene (PubChem CID 24745561) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-ethynyl-2,3-bis(methoxymethoxy)benzene.
| Compound Name | 1-ethynyl-2,3-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 24745561 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-ethynyl-2,3-bis(methoxymethoxy)benzene |
| SMILES | C#Cc1cccc(OCOC)c1OCOC |
| InChI | InChI=1S/C12H14O4/c1-4-10-6-5-7-11(15-8-13-2)12(10)16-9-14-3/h1,5-7H,8-9H2,2-3H3 |
| InChIKey | GSNYTPUZAMONOL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|