About CID 153450220
CID 153450220 (PubChem CID 153450220) has the molecular formula C9H9BNO4
and a molecular weight of 205.99 g/mol.
Molecular Properties
| Compound Name | CID 153450220 |
| PubChem CID | 153450220 |
| Molecular Formula | C9H9BNO4 |
| Molecular Weight | 205.99 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | — |
| SMILES | COCOc1c(C#N)cccc1O[B]O |
| InChI | InChI=1S/C9H9BNO4/c1-13-6-14-9-7(5-11)3-2-4-8(9)15-10-12/h2-4,12H,6H2,1H3 |
| InChIKey | BTGVYIAPPTWHFE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.99 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 153450220 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153450220?
The IUPAC name of CID 153450220 (CID 153450220) is not available.
What is the SMILES notation for CID 153450220?
The canonical SMILES for CID 153450220 is COCOc1c(C#N)cccc1O[B]O.
What is the InChIKey of CID 153450220?
The InChIKey is BTGVYIAPPTWHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BNO4/c1-13-6-14-9-7(5-11)3-2-4-8(9)15-10-12/h2-4,12H,6H2,1H3.
What are the key properties of CID 153450220?
CID 153450220 has a molecular weight of 205.99 g/mol, XLogP of 0.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153450220 is sourced from PubChem (CID 153450220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).