C12H15Cl2F3N2O2S — CID 24746798
1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine;hydrochloride (PubChem CID 24746798) has the molecular formula C12H15Cl2F3N2O2S and a molecular weight of 379.23 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine;hydrochloride.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 24746798 |
| Molecular Formula | C12H15Cl2F3N2O2S |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine;hydrochloride |
| SMILES | CN1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1.Cl |
| InChI | InChI=1S/C12H14ClF3N2O2S.ClH/c1-17-4-6-18(7-5-17)21(19,20)11-8-9(12(14,15)16)2-3-10(11)13;/h2-3,8H,4-7H2,1H3;1H |
| InChIKey | PRUPHIIINBIXSV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |