C13H19Cl2F3N2O2S — CID 45262346
2-chloro-N-[2-(diethylamino)ethyl]-5-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 45262346) has the molecular formula C13H19Cl2F3N2O2S and a molecular weight of 395.27 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)ethyl]-5-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-chloro-N-[2-(diethylamino)ethyl]-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 45262346 |
| Molecular Formula | C13H19Cl2F3N2O2S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)ethyl]-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | CCN(CC)CCNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl.Cl |
| InChI | InChI=1S/C13H18ClF3N2O2S.ClH/c1-3-19(4-2)8-7-18-22(20,21)12-9-10(13(15,16)17)5-6-11(12)14;/h5-6,9,18H,3-4,7-8H2,1-2H3;1H |
| InChIKey | VTYJNMGQJYWOFL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |