C20H25BrClN3O — CID 24746809
2-(4-benzylpiperazin-1-yl)-N-(2-bromo-4-methylphenyl)acetamide;hydrochloride (PubChem CID 24746809) has the molecular formula C20H25BrClN3O and a molecular weight of 438.80 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-(2-bromo-4-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-(2-bromo-4-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 24746809 |
| Molecular Formula | C20H25BrClN3O |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-(2-bromo-4-methylphenyl)acetamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CN2CCN(Cc3ccccc3)CC2)c(Br)c1.Cl |
| InChI | InChI=1S/C20H24BrN3O.ClH/c1-16-7-8-19(18(21)13-16)22-20(25)15-24-11-9-23(10-12-24)14-17-5-3-2-4-6-17;/h2-8,13H,9-12,14-15H2,1H3,(H,22,25);1H |
| InChIKey | HSHGKOKAPGPBMS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |