C18H28N2O3 — CID 24747515
(4aS,8R,8aS)-2-butyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one (PubChem CID 24747515) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (4aS,8R,8aS)-2-butyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one.
| Compound Name | (4aS,8R,8aS)-2-butyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 24747515 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (4aS,8R,8aS)-2-butyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
| SMILES | CCCCN1CC[C@H]2C=CC[C@@H](C(=O)N3CCOCC3)[C@H]2C1=O |
| InChI | InChI=1S/C18H28N2O3/c1-2-3-8-19-9-7-14-5-4-6-15(16(14)18(19)22)17(21)20-10-12-23-13-11-20/h4-5,14-16H,2-3,6-13H2,1H3/t14-,15-,16+/m1/s1 |
| InChIKey | KIZADJQKOVHVOZ-OAGGEKHMSA-N |
| XLogP | 1.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|