C19H19N7O3S — CID 24749265
[4-[(7-azido-1H-pyrrolo[2,3-c]pyridin-3-yl)sulfonyl]-3-methylpiperazin-1-yl]-phenylmethanone (PubChem CID 24749265) has the molecular formula C19H19N7O3S and a molecular weight of 425.47 g/mol. Its IUPAC name is [4-[(7-azido-1H-pyrrolo[2,3-c]pyridin-3-yl)sulfonyl]-3-methylpiperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[(7-azido-1H-pyrrolo[2,3-c]pyridin-3-yl)sulfonyl]-3-methylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 24749265 |
| Molecular Formula | C19H19N7O3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [4-[(7-azido-1H-pyrrolo[2,3-c]pyridin-3-yl)sulfonyl]-3-methylpiperazin-1-yl]-phenylmethanone |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1S(=O)(=O)c1c[nH]c2c(N=[N+]=[N-])nccc12 |
| InChI | InChI=1S/C19H19N7O3S/c1-13-12-25(19(27)14-5-3-2-4-6-14)9-10-26(13)30(28,29)16-11-22-17-15(16)7-8-21-18(17)23-24-20/h2-8,11,13,22H,9-10,12H2,1H3 |
| InChIKey | XTSQUFZTJWWRBK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|