C14H18N4O2 — CID 24749392
4-[3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)propyl]morpholine (PubChem CID 24749392) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)propyl]morpholine.
| Compound Name | 4-[3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)propyl]morpholine |
|---|---|
| PubChem CID | 24749392 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)propyl]morpholine |
| SMILES | [O-][n+]1nc(CCCN2CCOCC2)nc2ccccc21 |
| InChI | InChI=1S/C14H18N4O2/c19-18-13-5-2-1-4-12(13)15-14(16-18)6-3-7-17-8-10-20-11-9-17/h1-2,4-5H,3,6-11H2 |
| InChIKey | UMAKCZNDNVCKJL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|