C13H17ClN4O2 — CID 23030877
4-[2-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)ethyl]morpholine;hydrochloride (PubChem CID 23030877) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-[2-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)ethyl]morpholine;hydrochloride.
| Compound Name | 4-[2-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)ethyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 23030877 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[2-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)ethyl]morpholine;hydrochloride |
| SMILES | Cl.[O-][n+]1nc(CCN2CCOCC2)nc2ccccc21 |
| InChI | InChI=1S/C13H16N4O2.ClH/c18-17-12-4-2-1-3-11(12)14-13(15-17)5-6-16-7-9-19-10-8-16;/h1-4H,5-10H2;1H |
| InChIKey | SJYHPWHETIAWBQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|