C21H44N6O4 — CID 24749691
tert-butyl N-[N'-[3-[4-(3-aminopropylamino)butylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 24749691) has the molecular formula C21H44N6O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl N-[N'-[3-[4-(3-aminopropylamino)butylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[3-[4-(3-aminopropylamino)butylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 24749691 |
| Molecular Formula | C21H44N6O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | tert-butyl N-[N'-[3-[4-(3-aminopropylamino)butylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCNCCCCNCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H44N6O4/c1-20(2,3)30-18(28)26-17(27-19(29)31-21(4,5)6)25-16-10-15-24-13-8-7-12-23-14-9-11-22/h23-24H,7-16,22H2,1-6H3,(H2,25,26,27,28,29) |
| InChIKey | XKCJTAJSQQOQIH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|