C17H20F2N2OS — CID 24750084
2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl-5-fluoro(18F)aniline (PubChem CID 24750084) has the molecular formula C17H20F2N2OS and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl-5-fluoro(18F)aniline.
| Compound Name | 2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl-5-fluoro(18F)aniline |
|---|---|
| PubChem CID | 24750084 |
| Molecular Formula | C17H20F2N2OS |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl-5-fluoro(18F)aniline |
| SMILES | CN(C)Cc1cc(OCC[18F])ccc1Sc1ccc(F)cc1N |
| InChI | InChI=1S/C17H20F2N2OS/c1-21(2)11-12-9-14(22-8-7-18)4-6-16(12)23-17-5-3-13(19)10-15(17)20/h3-6,9-10H,7-8,11,20H2,1-2H3/i18-1 |
| InChIKey | XFIVQANHMYEPDG-SQZVAGKESA-N |
| XLogP | 3.97 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|