C17H22ClNO3 — CID 24750850
(2R)-1-(4-chlorobutyl)-2-(3,4-dimethoxyphenyl)-2,3-dihydropyridin-4-one (PubChem CID 24750850) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is (2R)-1-(4-chlorobutyl)-2-(3,4-dimethoxyphenyl)-2,3-dihydropyridin-4-one.
| Compound Name | (2R)-1-(4-chlorobutyl)-2-(3,4-dimethoxyphenyl)-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 24750850 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2R)-1-(4-chlorobutyl)-2-(3,4-dimethoxyphenyl)-2,3-dihydropyridin-4-one |
| SMILES | COc1ccc([C@H]2CC(=O)C=CN2CCCCCl)cc1OC |
| InChI | InChI=1S/C17H22ClNO3/c1-21-16-6-5-13(11-17(16)22-2)15-12-14(20)7-10-19(15)9-4-3-8-18/h5-7,10-11,15H,3-4,8-9,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | PCDXQGGQLVKTII-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|