About 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol
4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol (PubChem CID 24750954) has the molecular formula C20H26N2O4
and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol |
| PubChem CID | 24750954 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNC2CCCC[C@H]2NCc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C20H26N2O4/c23-17-7-5-13(9-19(17)25)11-21-15-3-1-2-4-16(15)22-12-14-6-8-18(24)20(26)10-14/h5-10,15-16,21-26H,1-4,11-12H2/t15-,16?/m1/s1 |
| InChIKey | VEMUWQYZTZVHIK-AAFJCEBUSA-N |
| XLogP | 2.70 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol?
The IUPAC name of 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol (CID 24750954) is 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol.
What is the SMILES notation for 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol?
The canonical SMILES for 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol is Oc1ccc(CNC2CCCC[C@H]2NCc2ccc(O)c(O)c2)cc1O.
What is the InChIKey of 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol?
The InChIKey is VEMUWQYZTZVHIK-AAFJCEBUSA-N. The full InChI is InChI=1S/C20H26N2O4/c23-17-7-5-13(9-19(17)25)11-21-15-3-1-2-4-16(15)22-12-14-6-8-18(24)20(26)10-14/h5-10,15-16,21-26H,1-4,11-12H2/t15-,16?/m1/s1.
What are the key properties of 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol?
4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol has a molecular weight of 358.44 g/mol, XLogP of 2.70, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol is sourced from PubChem (CID 24750954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).