C20H26N2O4 — CID 24750954
4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol (PubChem CID 24750954) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 24750954 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-[[[(2R)-2-[(3,4-dihydroxyphenyl)methylamino]cyclohexyl]amino]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNC2CCCC[C@H]2NCc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C20H26N2O4/c23-17-7-5-13(9-19(17)25)11-21-15-3-1-2-4-16(15)22-12-14-6-8-18(24)20(26)10-14/h5-10,15-16,21-26H,1-4,11-12H2/t15-,16?/m1/s1 |
| InChIKey | VEMUWQYZTZVHIK-AAFJCEBUSA-N |
| XLogP | 2.70 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|