C14H18F3NO2 — CID 43434626
4-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]benzene-1,2-diol (PubChem CID 43434626) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43434626 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNC2CCC(C(F)(F)F)CC2)cc1O |
| InChI | InChI=1S/C14H18F3NO2/c15-14(16,17)10-2-4-11(5-3-10)18-8-9-1-6-12(19)13(20)7-9/h1,6-7,10-11,18-20H,2-5,8H2 |
| InChIKey | LEPLLFQZXZDRQK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|