C15H24N2O2 — CID 28716549
4-[[(1-propan-2-ylpiperidin-4-yl)amino]methyl]benzene-1,2-diol (PubChem CID 28716549) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-[[(1-propan-2-ylpiperidin-4-yl)amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(1-propan-2-ylpiperidin-4-yl)amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 28716549 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4-[[(1-propan-2-ylpiperidin-4-yl)amino]methyl]benzene-1,2-diol |
| SMILES | CC(C)N1CCC(NCc2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-11(2)17-7-5-13(6-8-17)16-10-12-3-4-14(18)15(19)9-12/h3-4,9,11,13,16,18-19H,5-8,10H2,1-2H3 |
| InChIKey | SCHITULUYJQVNO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|