C20H21ClN4O3S — CID 24751017
ethyl 6-[4-(benzoylcarbamothioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate (PubChem CID 24751017) has the molecular formula C20H21ClN4O3S and a molecular weight of 432.93 g/mol. Its IUPAC name is ethyl 6-[4-(benzoylcarbamothioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(benzoylcarbamothioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 24751017 |
| Molecular Formula | C20H21ClN4O3S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | ethyl 6-[4-(benzoylcarbamothioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=S)NC(=O)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H21ClN4O3S/c1-2-28-19(27)15-12-16(21)17(22-13-15)24-8-10-25(11-9-24)20(29)23-18(26)14-6-4-3-5-7-14/h3-7,12-13H,2,8-11H2,1H3,(H,23,26,29) |
| InChIKey | XEVZZYBNUICMPS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|