C20H23ClN4O4 — CID 24751579
ethyl 5-chloro-6-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 24751579) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is ethyl 5-chloro-6-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-chloro-6-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 24751579 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 5-chloro-6-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=O)Nc3ccccc3OC)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN4O4/c1-3-29-19(26)14-12-15(21)18(22-13-14)24-8-10-25(11-9-24)20(27)23-16-6-4-5-7-17(16)28-2/h4-7,12-13H,3,8-11H2,1-2H3,(H,23,27) |
| InChIKey | XBMCBLWILIVBDL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |