C26H24F3NO3S — CID 24751779
5-[1-methyl-5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]indol-2-yl]pentanoic acid (PubChem CID 24751779) has the molecular formula C26H24F3NO3S and a molecular weight of 487.54 g/mol. Its IUPAC name is 5-[1-methyl-5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]indol-2-yl]pentanoic acid.
| Compound Name | 5-[1-methyl-5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]indol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 24751779 |
| Molecular Formula | C26H24F3NO3S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 5-[1-methyl-5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]indol-2-yl]pentanoic acid |
| SMILES | Cn1c(CCCCC(=O)O)cc2cc(OCc3cc(-c4ccccc4)c(C(F)(F)F)s3)ccc21 |
| InChI | InChI=1S/C26H24F3NO3S/c1-30-19(9-5-6-10-24(31)32)13-18-14-20(11-12-23(18)30)33-16-21-15-22(17-7-3-2-4-8-17)25(34-21)26(27,28)29/h2-4,7-8,11-15H,5-6,9-10,16H2,1H3,(H,31,32) |
| InChIKey | OOJHGNMEELIPEW-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|