C23H21F7N2O — CID 24752606
2-[(3R,4S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]acetonitrile (PubChem CID 24752606) has the molecular formula C23H21F7N2O and a molecular weight of 474.42 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[(3R,4S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 24752606 |
| Molecular Formula | C23H21F7N2O |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[(3R,4S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CC[C@H](c2ccc(F)cc2)[C@@H](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C23H21F7N2O/c24-20-3-1-16(2-4-20)21-5-7-32(8-6-31)12-17(21)14-33-13-15-9-18(22(25,26)27)11-19(10-15)23(28,29)30/h1-4,9-11,17,21H,5,7-8,12-14H2/t17-,21-/m1/s1 |
| InChIKey | IPCLVUXHQKRJMB-DYESRHJHSA-N |
| XLogP | 6.01 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|