C22H20ClF6N3O2 — CID 22393919
2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]acetonitrile;hydrochloride (PubChem CID 22393919) has the molecular formula C22H20ClF6N3O2 and a molecular weight of 507.86 g/mol. Its IUPAC name is 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]acetonitrile;hydrochloride.
| Compound Name | 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]acetonitrile;hydrochloride |
|---|---|
| PubChem CID | 22393919 |
| Molecular Formula | C22H20ClF6N3O2 |
| Molecular Weight | 507.86 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]acetonitrile;hydrochloride |
| SMILES | Cl.N#CCN1CC(=O)NC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C22H19F6N3O2.ClH/c23-21(24,25)16-8-14(9-17(10-16)22(26,27)28)12-33-13-18-20(15-4-2-1-3-5-15)31(7-6-29)11-19(32)30-18;/h1-5,8-10,18,20H,7,11-13H2,(H,30,32);1H |
| InChIKey | LZHZMGMIETVTHQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|