C18H19Cl2FN2O — CID 24753203
(2S)-2-(3,4-dichlorophenyl)-N-[(5-ethyl-2-fluoro-3-pyridinyl)methyl]butanamide (PubChem CID 24753203) has the molecular formula C18H19Cl2FN2O and a molecular weight of 369.27 g/mol. Its IUPAC name is (2S)-2-(3,4-dichlorophenyl)-N-[(5-ethyl-2-fluoro-3-pyridinyl)methyl]butanamide.
| Compound Name | (2S)-2-(3,4-dichlorophenyl)-N-[(5-ethyl-2-fluoro-3-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 24753203 |
| Molecular Formula | C18H19Cl2FN2O |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (2S)-2-(3,4-dichlorophenyl)-N-[(5-ethyl-2-fluoro-3-pyridinyl)methyl]butanamide |
| SMILES | CCc1cnc(F)c(CNC(=O)[C@@H](CC)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H19Cl2FN2O/c1-3-11-7-13(17(21)22-9-11)10-23-18(24)14(4-2)12-5-6-15(19)16(20)8-12/h5-9,14H,3-4,10H2,1-2H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | BSGFWEFOJNJGAZ-AWEZNQCLSA-N |
| XLogP | 4.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|