C18H23N5O3 — CID 24753585
7-(2-methoxyethoxy)-4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-propan-2-ylphthalazin-1-one (PubChem CID 24753585) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-propan-2-ylphthalazin-1-one.
| Compound Name | 7-(2-methoxyethoxy)-4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-propan-2-ylphthalazin-1-one |
|---|---|
| PubChem CID | 24753585 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 7-(2-methoxyethoxy)-4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-propan-2-ylphthalazin-1-one |
| SMILES | COCCOc1ccc2c(Nc3cc(C)[nH]n3)nn(C(C)C)c(=O)c2c1 |
| InChI | InChI=1S/C18H23N5O3/c1-11(2)23-18(24)15-10-13(26-8-7-25-4)5-6-14(15)17(22-23)19-16-9-12(3)20-21-16/h5-6,9-11H,7-8H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | BDISOSDIUPFTJJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|