C21H19N5O3 — CID 11501979
2-[2-(4-methoxyphenyl)-2-oxoethyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]phthalazin-1-one (PubChem CID 11501979) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-2-oxoethyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]phthalazin-1-one.
| Compound Name | 2-[2-(4-methoxyphenyl)-2-oxoethyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]phthalazin-1-one |
|---|---|
| PubChem CID | 11501979 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-2-oxoethyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]phthalazin-1-one |
| SMILES | COc1ccc(C(=O)Cn2nc(Nc3cc(C)[nH]n3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H19N5O3/c1-13-11-19(24-23-13)22-20-16-5-3-4-6-17(16)21(28)26(25-20)12-18(27)14-7-9-15(29-2)10-8-14/h3-11H,12H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | NCMYFWCPWPQBIF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |